C21H22N5O4+ — CID 7327344
2-[4-(4,5-dicyano-2-nitroanilino)benzoyl]oxyethyl-diethylazanium (PubChem CID 7327344) has the molecular formula C21H22N5O4+ and a molecular weight of 408.44 g/mol. Its IUPAC name is 2-[4-(4,5-dicyano-2-nitroanilino)benzoyl]oxyethyl-diethylazanium.
| Compound Name | 2-[4-(4,5-dicyano-2-nitroanilino)benzoyl]oxyethyl-diethylazanium |
|---|---|
| PubChem CID | 7327344 |
| Molecular Formula | C21H22N5O4+ |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-[4-(4,5-dicyano-2-nitroanilino)benzoyl]oxyethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCOC(=O)c1ccc(Nc2cc(C#N)c(C#N)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H21N5O4/c1-3-25(4-2)9-10-30-21(27)15-5-7-18(8-6-15)24-19-11-16(13-22)17(14-23)12-20(19)26(28)29/h5-8,11-12,24H,3-4,9-10H2,1-2H3/p+1 |
| InChIKey | KRTZIBQWTPQWOQ-UHFFFAOYSA-O |
| XLogP | 2.16 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|