C16H24N6O4 — CID 73281500
methyl 2-[4-(3-methyl-2,6-dioxo-7-prop-2-enyl-4,5-dihydropurin-8-yl)piperazin-1-yl]acetate (PubChem CID 73281500) has the molecular formula C16H24N6O4 and a molecular weight of 364.41 g/mol. Its IUPAC name is methyl 2-[4-(3-methyl-2,6-dioxo-7-prop-2-enyl-4,5-dihydropurin-8-yl)piperazin-1-yl]acetate.
| Compound Name | methyl 2-[4-(3-methyl-2,6-dioxo-7-prop-2-enyl-4,5-dihydropurin-8-yl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 73281500 |
| Molecular Formula | C16H24N6O4 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | methyl 2-[4-(3-methyl-2,6-dioxo-7-prop-2-enyl-4,5-dihydropurin-8-yl)piperazin-1-yl]acetate |
| SMILES | C=CCN1C(N2CCN(CC(=O)OC)CC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C16H24N6O4/c1-4-5-22-12-13(19(2)16(25)18-14(12)24)17-15(22)21-8-6-20(7-9-21)10-11(23)26-3/h4,12-13H,1,5-10H2,2-3H3,(H,18,24,25) |
| InChIKey | MZRNNDMQFWSYLF-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|