C17H26N6O4 — CID 73327370
ethyl 2-[4-(3-methyl-2,6-dioxo-7-prop-2-enyl-4,5-dihydropurin-8-yl)piperazin-1-yl]acetate (PubChem CID 73327370) has the molecular formula C17H26N6O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is ethyl 2-[4-(3-methyl-2,6-dioxo-7-prop-2-enyl-4,5-dihydropurin-8-yl)piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-(3-methyl-2,6-dioxo-7-prop-2-enyl-4,5-dihydropurin-8-yl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 73327370 |
| Molecular Formula | C17H26N6O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | ethyl 2-[4-(3-methyl-2,6-dioxo-7-prop-2-enyl-4,5-dihydropurin-8-yl)piperazin-1-yl]acetate |
| SMILES | C=CCN1C(N2CCN(CC(=O)OCC)CC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C17H26N6O4/c1-4-6-23-13-14(20(3)17(26)19-15(13)25)18-16(23)22-9-7-21(8-10-22)11-12(24)27-5-2/h4,13-14H,1,5-11H2,2-3H3,(H,19,25,26) |
| InChIKey | AGJBITOKIFOYBM-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|