C20H34N6O4 — CID 73327367
ethyl 2-[4-(7-hexyl-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl)piperazin-1-yl]acetate (PubChem CID 73327367) has the molecular formula C20H34N6O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is ethyl 2-[4-(7-hexyl-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl)piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-(7-hexyl-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 73327367 |
| Molecular Formula | C20H34N6O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | ethyl 2-[4-(7-hexyl-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl)piperazin-1-yl]acetate |
| SMILES | CCCCCCN1C(N2CCN(CC(=O)OCC)CC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C20H34N6O4/c1-4-6-7-8-9-26-16-17(23(3)20(29)22-18(16)28)21-19(26)25-12-10-24(11-13-25)14-15(27)30-5-2/h16-17H,4-14H2,1-3H3,(H,22,28,29) |
| InChIKey | NKSONWCIZLIXLE-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|