C19H30N6O2 — CID 73284291
6-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione (PubChem CID 73284291) has the molecular formula C19H30N6O2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 6-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 73284291 |
| Molecular Formula | C19H30N6O2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 6-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione |
| SMILES | CC1=C(C)N2C(=NC3C2C(=O)NC(=O)N3C)N1CCN1CC(C)CC(C)C1 |
| InChI | InChI=1S/C19H30N6O2/c1-11-8-12(2)10-23(9-11)6-7-24-13(3)14(4)25-15-16(20-18(24)25)22(5)19(27)21-17(15)26/h11-12,15-16H,6-10H2,1-5H3,(H,21,26,27) |
| InChIKey | LMVJNZJGGLCRMG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |