C16H22F3NO3 — CID 73292268
(2S,3R,4R,5R,6R)-2-methyl-6-[3-[4-(trifluoromethyl)phenyl]propyl]piperidine-3,4,5-triol (PubChem CID 73292268) has the molecular formula C16H22F3NO3 and a molecular weight of 333.35 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-methyl-6-[3-[4-(trifluoromethyl)phenyl]propyl]piperidine-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R,6R)-2-methyl-6-[3-[4-(trifluoromethyl)phenyl]propyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 73292268 |
| Molecular Formula | C16H22F3NO3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-methyl-6-[3-[4-(trifluoromethyl)phenyl]propyl]piperidine-3,4,5-triol |
| SMILES | C[C@@H]1N[C@H](CCCc2ccc(C(F)(F)F)cc2)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H22F3NO3/c1-9-13(21)15(23)14(22)12(20-9)4-2-3-10-5-7-11(8-6-10)16(17,18)19/h5-9,12-15,20-23H,2-4H2,1H3/t9-,12+,13+,14+,15+/m0/s1 |
| InChIKey | DECRMWSYZZFEND-JZLHEVAFSA-N |
| XLogP | 1.47 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |