C26H31N5O3 — CID 73293249
(4R)-7,8-dimethoxy-N,4-dimethyl-1-[4-(1,3,5-trimethylpyrazol-4-yl)phenyl]-4,5-dihydro-2,3-benzodiazepine-3-carboxamide (PubChem CID 73293249) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is (4R)-7,8-dimethoxy-N,4-dimethyl-1-[4-(1,3,5-trimethylpyrazol-4-yl)phenyl]-4,5-dihydro-2,3-benzodiazepine-3-carboxamide.
| Compound Name | (4R)-7,8-dimethoxy-N,4-dimethyl-1-[4-(1,3,5-trimethylpyrazol-4-yl)phenyl]-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 73293249 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | (4R)-7,8-dimethoxy-N,4-dimethyl-1-[4-(1,3,5-trimethylpyrazol-4-yl)phenyl]-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
| SMILES | CNC(=O)N1N=C(c2ccc(-c3c(C)nn(C)c3C)cc2)c2cc(OC)c(OC)cc2C[C@H]1C |
| InChI | InChI=1S/C26H31N5O3/c1-15-12-20-13-22(33-6)23(34-7)14-21(20)25(29-31(15)26(32)27-4)19-10-8-18(9-11-19)24-16(2)28-30(5)17(24)3/h8-11,13-15H,12H2,1-7H3,(H,27,32)/t15-/m1/s1 |
| InChIKey | GEBVCSMARNXRFJ-OAHLLOKOSA-N |
| XLogP | 4.06 |
| TPSA | 80.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |