C19H18N2O2 — CID 73294043
11,11-dimethyl-14-propyl-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,12-hexaene-10,15-dione (PubChem CID 73294043) has the molecular formula C19H18N2O2 and a molecular weight of 306.36 g/mol. Its IUPAC name is 11,11-dimethyl-14-propyl-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,12-hexaene-10,15-dione.
| Compound Name | 11,11-dimethyl-14-propyl-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,12-hexaene-10,15-dione |
|---|---|
| PubChem CID | 73294043 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 11,11-dimethyl-14-propyl-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,12-hexaene-10,15-dione |
| SMILES | CCCN1C(=O)c2c3c(nc4ccccc24)C(=O)C(C)(C)C=C31 |
| InChI | InChI=1S/C19H18N2O2/c1-4-9-21-13-10-19(2,3)17(22)16-15(13)14(18(21)23)11-7-5-6-8-12(11)20-16/h5-8,10H,4,9H2,1-3H3 |
| InChIKey | CDRXKYLCEAGLEV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |