C22H21F3N4O4S — CID 73297062
4-[[3-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]phenyl]sulfonylamino]butanoic acid (PubChem CID 73297062) has the molecular formula C22H21F3N4O4S and a molecular weight of 494.50 g/mol. Its IUPAC name is 4-[[3-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]phenyl]sulfonylamino]butanoic acid.
| Compound Name | 4-[[3-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]phenyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 73297062 |
| Molecular Formula | C22H21F3N4O4S |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 4-[[3-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]phenyl]sulfonylamino]butanoic acid |
| SMILES | Cc1cc(Nc2nccc(C(F)(F)F)n2)cc(-c2cccc(S(=O)(=O)NCCCC(=O)O)c2)c1 |
| InChI | InChI=1S/C22H21F3N4O4S/c1-14-10-16(12-17(11-14)28-21-26-9-7-19(29-21)22(23,24)25)15-4-2-5-18(13-15)34(32,33)27-8-3-6-20(30)31/h2,4-5,7,9-13,27H,3,6,8H2,1H3,(H,30,31)(H,26,28,29) |
| InChIKey | APHHQOPJGIWFBS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|