C25H26F3N3O5 — CID 73301342
3-[4-[2-[6-(C-cyclopropyl-N-methoxycarbonimidoyl)pyrrolo[2,3-b]pyridin-1-yl]ethoxy]phenyl]-2-(2,2,2-trifluoroethoxy)propanoic acid (PubChem CID 73301342) has the molecular formula C25H26F3N3O5 and a molecular weight of 505.49 g/mol. Its IUPAC name is 3-[4-[2-[6-(C-cyclopropyl-N-methoxycarbonimidoyl)pyrrolo[2,3-b]pyridin-1-yl]ethoxy]phenyl]-2-(2,2,2-trifluoroethoxy)propanoic acid.
| Compound Name | 3-[4-[2-[6-(C-cyclopropyl-N-methoxycarbonimidoyl)pyrrolo[2,3-b]pyridin-1-yl]ethoxy]phenyl]-2-(2,2,2-trifluoroethoxy)propanoic acid |
|---|---|
| PubChem CID | 73301342 |
| Molecular Formula | C25H26F3N3O5 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 3-[4-[2-[6-(C-cyclopropyl-N-methoxycarbonimidoyl)pyrrolo[2,3-b]pyridin-1-yl]ethoxy]phenyl]-2-(2,2,2-trifluoroethoxy)propanoic acid |
| SMILES | CON=C(c1ccc2ccn(CCOc3ccc(CC(OCC(F)(F)F)C(=O)O)cc3)c2n1)C1CC1 |
| InChI | InChI=1S/C25H26F3N3O5/c1-34-30-22(17-4-5-17)20-9-6-18-10-11-31(23(18)29-20)12-13-35-19-7-2-16(3-8-19)14-21(24(32)33)36-15-25(26,27)28/h2-3,6-11,17,21H,4-5,12-15H2,1H3,(H,32,33) |
| InChIKey | HYZLBIFWAIZONL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|