C28H32F3N3O5 — CID 16661629
3-[4-[2-[6-[(E)-C-cyclohexyl-N-methoxycarbonimidoyl]pyrrolo[2,3-b]pyridin-1-yl]ethoxy]phenyl]-2-(2,2,2-trifluoroethoxy)propanoic acid (PubChem CID 16661629) has the molecular formula C28H32F3N3O5 and a molecular weight of 547.57 g/mol. Its IUPAC name is 3-[4-[2-[6-[(E)-C-cyclohexyl-N-methoxycarbonimidoyl]pyrrolo[2,3-b]pyridin-1-yl]ethoxy]phenyl]-2-(2,2,2-trifluoroethoxy)propanoic acid.
| Compound Name | 3-[4-[2-[6-[(E)-C-cyclohexyl-N-methoxycarbonimidoyl]pyrrolo[2,3-b]pyridin-1-yl]ethoxy]phenyl]-2-(2,2,2-trifluoroethoxy)propanoic acid |
|---|---|
| PubChem CID | 16661629 |
| Molecular Formula | C28H32F3N3O5 |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | 3-[4-[2-[6-[(E)-C-cyclohexyl-N-methoxycarbonimidoyl]pyrrolo[2,3-b]pyridin-1-yl]ethoxy]phenyl]-2-(2,2,2-trifluoroethoxy)propanoic acid |
| SMILES | CO/N=C(/c1ccc2ccn(CCOc3ccc(CC(OCC(F)(F)F)C(=O)O)cc3)c2n1)C1CCCCC1 |
| InChI | InChI=1S/C28H32F3N3O5/c1-37-33-25(20-5-3-2-4-6-20)23-12-9-21-13-14-34(26(21)32-23)15-16-38-22-10-7-19(8-11-22)17-24(27(35)36)39-18-28(29,30)31/h7-14,20,24H,2-6,15-18H2,1H3,(H,35,36)/b33-25+ |
| InChIKey | BZFFVQPSPQFQPX-INKHBPHZSA-N |
| XLogP | 5.62 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|