C28H35N3O5 — CID 87653358
(2S)-3-[4-[2-[6-[(Z)-C-cyclohexyl-N-methoxycarbonimidoyl]pyrrolo[2,3-b]pyridin-1-yl]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 87653358) has the molecular formula C28H35N3O5 and a molecular weight of 493.60 g/mol. Its IUPAC name is (2S)-3-[4-[2-[6-[(Z)-C-cyclohexyl-N-methoxycarbonimidoyl]pyrrolo[2,3-b]pyridin-1-yl]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | (2S)-3-[4-[2-[6-[(Z)-C-cyclohexyl-N-methoxycarbonimidoyl]pyrrolo[2,3-b]pyridin-1-yl]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 87653358 |
| Molecular Formula | C28H35N3O5 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | (2S)-3-[4-[2-[6-[(Z)-C-cyclohexyl-N-methoxycarbonimidoyl]pyrrolo[2,3-b]pyridin-1-yl]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCO[C@@H](Cc1ccc(OCCn2ccc3ccc(/C(=N\OC)C4CCCCC4)nc32)cc1)C(=O)O |
| InChI | InChI=1S/C28H35N3O5/c1-3-35-25(28(32)33)19-20-9-12-23(13-10-20)36-18-17-31-16-15-22-11-14-24(29-27(22)31)26(30-34-2)21-7-5-4-6-8-21/h9-16,21,25H,3-8,17-19H2,1-2H3,(H,32,33)/b30-26-/t25-/m0/s1 |
| InChIKey | JZCRBSJTJOYZJF-YVARBQMLSA-N |
| XLogP | 5.08 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|