C15H26N5O2+ — CID 73328332
[1,3-dimethyl-7-(2-methylpropyl)-2,6-dioxo-5H-purin-8-ylidene]-diethylazanium (PubChem CID 73328332) has the molecular formula C15H26N5O2+ and a molecular weight of 308.41 g/mol. Its IUPAC name is [1,3-dimethyl-7-(2-methylpropyl)-2,6-dioxo-5H-purin-8-ylidene]-diethylazanium.
| Compound Name | [1,3-dimethyl-7-(2-methylpropyl)-2,6-dioxo-5H-purin-8-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 73328332 |
| Molecular Formula | C15H26N5O2+ |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | [1,3-dimethyl-7-(2-methylpropyl)-2,6-dioxo-5H-purin-8-ylidene]-diethylazanium |
| SMILES | CC[N+](CC)=C1N=C2C(C(=O)N(C)C(=O)N2C)N1CC(C)C |
| InChI | InChI=1S/C15H26N5O2/c1-7-19(8-2)14-16-12-11(20(14)9-10(3)4)13(21)18(6)15(22)17(12)5/h10-11H,7-9H2,1-6H3/q+1 |
| InChIKey | WGDDDRPHSGIJFI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|