C20H20ClN3O6 — CID 73329512
N-(5-chloro-2-methoxyphenyl)-1-(3,4-dimethoxyphenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide (PubChem CID 73329512) has the molecular formula C20H20ClN3O6 and a molecular weight of 433.85 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-1-(3,4-dimethoxyphenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-1-(3,4-dimethoxyphenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 73329512 |
| Molecular Formula | C20H20ClN3O6 |
| Molecular Weight | 433.85 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-1-(3,4-dimethoxyphenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C1CNC(=O)N(c2ccc(OC)c(OC)c2)C1=O |
| InChI | InChI=1S/C20H20ClN3O6/c1-28-15-6-4-11(21)8-14(15)23-18(25)13-10-22-20(27)24(19(13)26)12-5-7-16(29-2)17(9-12)30-3/h4-9,13H,10H2,1-3H3,(H,22,27)(H,23,25) |
| InChIKey | PBUFRGRASYRPEW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.85 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|