C20H19N3O7 — CID 78444230
N-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide (PubChem CID 78444230) has the molecular formula C20H19N3O7 and a molecular weight of 413.39 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 78444230 |
| Molecular Formula | C20H19N3O7 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide |
| SMILES | COc1ccc(N2C(=O)NCC(C(=O)Nc3ccc4c(c3)OCO4)C2=O)cc1OC |
| InChI | InChI=1S/C20H19N3O7/c1-27-14-6-4-12(8-16(14)28-2)23-19(25)13(9-21-20(23)26)18(24)22-11-3-5-15-17(7-11)30-10-29-15/h3-8,13H,9-10H2,1-2H3,(H,21,26)(H,22,24) |
| InChIKey | LWBXBBKZMSXRDP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|