C20H21N3O5 — CID 78450873
N-(2-methoxy-5-methylphenyl)-1-(3-methoxyphenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide (PubChem CID 78450873) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is N-(2-methoxy-5-methylphenyl)-1-(3-methoxyphenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide.
| Compound Name | N-(2-methoxy-5-methylphenyl)-1-(3-methoxyphenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 78450873 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-(2-methoxy-5-methylphenyl)-1-(3-methoxyphenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide |
| SMILES | COc1cccc(N2C(=O)NCC(C(=O)Nc3cc(C)ccc3OC)C2=O)c1 |
| InChI | InChI=1S/C20H21N3O5/c1-12-7-8-17(28-3)16(9-12)22-18(24)15-11-21-20(26)23(19(15)25)13-5-4-6-14(10-13)27-2/h4-10,15H,11H2,1-3H3,(H,21,26)(H,22,24) |
| InChIKey | XRFRVEPCAZQSAE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|