C8H13NO3S — CID 73330341
(Z)-2-[[(1S)-cyclohex-3-en-1-yl]amino]ethenesulfonic acid (PubChem CID 73330341) has the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. Its IUPAC name is (Z)-2-[[(1S)-cyclohex-3-en-1-yl]amino]ethenesulfonic acid.
| Compound Name | (Z)-2-[[(1S)-cyclohex-3-en-1-yl]amino]ethenesulfonic acid |
|---|---|
| PubChem CID | 73330341 |
| Molecular Formula | C8H13NO3S |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | (Z)-2-[[(1S)-cyclohex-3-en-1-yl]amino]ethenesulfonic acid |
| SMILES | O=S(=O)(O)/C=C\N[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C8H13NO3S/c10-13(11,12)7-6-9-8-4-2-1-3-5-8/h1-2,6-9H,3-5H2,(H,10,11,12)/b7-6-/t8-/m1/s1 |
| InChIKey | XACBCDWHNBLRQQ-NFXKFNAJSA-N |
| XLogP | 1.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|