About (3R)-1-(2,3-dimethylphenyl)-4-(2-methoxyphenyl)-3-thiophen-2-ylpiperazine-2,5-dione
(3R)-1-(2,3-dimethylphenyl)-4-(2-methoxyphenyl)-3-thiophen-2-ylpiperazine-2,5-dione (PubChem CID 7333055) has the molecular formula C23H22N2O3S
and a molecular weight of 406.51 g/mol. Its IUPAC name is (3R)-1-(2,3-dimethylphenyl)-4-(2-methoxyphenyl)-3-thiophen-2-ylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | (3R)-1-(2,3-dimethylphenyl)-4-(2-methoxyphenyl)-3-thiophen-2-ylpiperazine-2,5-dione |
| PubChem CID | 7333055 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | (3R)-1-(2,3-dimethylphenyl)-4-(2-methoxyphenyl)-3-thiophen-2-ylpiperazine-2,5-dione |
| SMILES | COc1ccccc1N1C(=O)CN(c2cccc(C)c2C)C(=O)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C23H22N2O3S/c1-15-8-6-10-17(16(15)2)24-14-21(26)25(18-9-4-5-11-19(18)28-3)22(23(24)27)20-12-7-13-29-20/h4-13,22H,14H2,1-3H3/t22-/m0/s1 |
| InChIKey | HPGPJFRYSDWUFR-QFIPXVFZSA-N |
| XLogP | 4.49 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-1-(2,3-dimethylphenyl)-4-(2-methoxyphenyl)-3-thiophen-2-ylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(2,3-dimethylphenyl)-4-(2-methoxyphenyl)-3-thiophen-2-ylpiperazine-2,5-dione?
The IUPAC name of (3R)-1-(2,3-dimethylphenyl)-4-(2-methoxyphenyl)-3-thiophen-2-ylpiperazine-2,5-dione (CID 7333055) is (3R)-1-(2,3-dimethylphenyl)-4-(2-methoxyphenyl)-3-thiophen-2-ylpiperazine-2,5-dione.
What is the SMILES notation for (3R)-1-(2,3-dimethylphenyl)-4-(2-methoxyphenyl)-3-thiophen-2-ylpiperazine-2,5-dione?
The canonical SMILES for (3R)-1-(2,3-dimethylphenyl)-4-(2-methoxyphenyl)-3-thiophen-2-ylpiperazine-2,5-dione is COc1ccccc1N1C(=O)CN(c2cccc(C)c2C)C(=O)[C@@H]1c1cccs1.
What is the InChIKey of (3R)-1-(2,3-dimethylphenyl)-4-(2-methoxyphenyl)-3-thiophen-2-ylpiperazine-2,5-dione?
The InChIKey is HPGPJFRYSDWUFR-QFIPXVFZSA-N. The full InChI is InChI=1S/C23H22N2O3S/c1-15-8-6-10-17(16(15)2)24-14-21(26)25(18-9-4-5-11-19(18)28-3)22(23(24)27)20-12-7-13-29-20/h4-13,22H,14H2,1-3H3/t22-/m0/s1.
What are the key properties of (3R)-1-(2,3-dimethylphenyl)-4-(2-methoxyphenyl)-3-thiophen-2-ylpiperazine-2,5-dione?
(3R)-1-(2,3-dimethylphenyl)-4-(2-methoxyphenyl)-3-thiophen-2-ylpiperazine-2,5-dione has a molecular weight of 406.51 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(2,3-dimethylphenyl)-4-(2-methoxyphenyl)-3-thiophen-2-ylpiperazine-2,5-dione is sourced from PubChem (CID 7333055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).