C22H20N2O2S — CID 7693694
(3R)-1-(2,3-dimethylphenyl)-4-phenyl-3-thiophen-2-ylpiperazine-2,5-dione (PubChem CID 7693694) has the molecular formula C22H20N2O2S and a molecular weight of 376.48 g/mol. Its IUPAC name is (3R)-1-(2,3-dimethylphenyl)-4-phenyl-3-thiophen-2-ylpiperazine-2,5-dione.
| Compound Name | (3R)-1-(2,3-dimethylphenyl)-4-phenyl-3-thiophen-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 7693694 |
| Molecular Formula | C22H20N2O2S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (3R)-1-(2,3-dimethylphenyl)-4-phenyl-3-thiophen-2-ylpiperazine-2,5-dione |
| SMILES | Cc1cccc(N2CC(=O)N(c3ccccc3)[C@@H](c3cccs3)C2=O)c1C |
| InChI | InChI=1S/C22H20N2O2S/c1-15-8-6-11-18(16(15)2)23-14-20(25)24(17-9-4-3-5-10-17)21(22(23)26)19-12-7-13-27-19/h3-13,21H,14H2,1-2H3/t21-/m0/s1 |
| InChIKey | NGQFWYDMVUERJR-NRFANRHFSA-N |
| XLogP | 4.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |