About (3R)-1-(2,6-dimethylphenyl)-4-phenyl-3-(4-propan-2-ylphenyl)piperazine-2,5-dione
(3R)-1-(2,6-dimethylphenyl)-4-phenyl-3-(4-propan-2-ylphenyl)piperazine-2,5-dione (PubChem CID 7097601) has the molecular formula C27H28N2O2
and a molecular weight of 412.53 g/mol. Its IUPAC name is (3R)-1-(2,6-dimethylphenyl)-4-phenyl-3-(4-propan-2-ylphenyl)piperazine-2,5-dione.
Molecular Properties
| Compound Name | (3R)-1-(2,6-dimethylphenyl)-4-phenyl-3-(4-propan-2-ylphenyl)piperazine-2,5-dione |
| PubChem CID | 7097601 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (3R)-1-(2,6-dimethylphenyl)-4-phenyl-3-(4-propan-2-ylphenyl)piperazine-2,5-dione |
| SMILES | Cc1cccc(C)c1N1CC(=O)N(c2ccccc2)[C@H](c2ccc(C(C)C)cc2)C1=O |
| InChI | InChI=1S/C27H28N2O2/c1-18(2)21-13-15-22(16-14-21)26-27(31)28(25-19(3)9-8-10-20(25)4)17-24(30)29(26)23-11-6-5-7-12-23/h5-16,18,26H,17H2,1-4H3/t26-/m1/s1 |
| InChIKey | IKRVSKOKJJXHDN-AREMUKBSSA-N |
| XLogP | 5.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-1-(2,6-dimethylphenyl)-4-phenyl-3-(4-propan-2-ylphenyl)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(2,6-dimethylphenyl)-4-phenyl-3-(4-propan-2-ylphenyl)piperazine-2,5-dione?
The IUPAC name of (3R)-1-(2,6-dimethylphenyl)-4-phenyl-3-(4-propan-2-ylphenyl)piperazine-2,5-dione (CID 7097601) is (3R)-1-(2,6-dimethylphenyl)-4-phenyl-3-(4-propan-2-ylphenyl)piperazine-2,5-dione.
What is the SMILES notation for (3R)-1-(2,6-dimethylphenyl)-4-phenyl-3-(4-propan-2-ylphenyl)piperazine-2,5-dione?
The canonical SMILES for (3R)-1-(2,6-dimethylphenyl)-4-phenyl-3-(4-propan-2-ylphenyl)piperazine-2,5-dione is Cc1cccc(C)c1N1CC(=O)N(c2ccccc2)[C@H](c2ccc(C(C)C)cc2)C1=O.
What is the InChIKey of (3R)-1-(2,6-dimethylphenyl)-4-phenyl-3-(4-propan-2-ylphenyl)piperazine-2,5-dione?
The InChIKey is IKRVSKOKJJXHDN-AREMUKBSSA-N. The full InChI is InChI=1S/C27H28N2O2/c1-18(2)21-13-15-22(16-14-21)26-27(31)28(25-19(3)9-8-10-20(25)4)17-24(30)29(26)23-11-6-5-7-12-23/h5-16,18,26H,17H2,1-4H3/t26-/m1/s1.
What are the key properties of (3R)-1-(2,6-dimethylphenyl)-4-phenyl-3-(4-propan-2-ylphenyl)piperazine-2,5-dione?
(3R)-1-(2,6-dimethylphenyl)-4-phenyl-3-(4-propan-2-ylphenyl)piperazine-2,5-dione has a molecular weight of 412.53 g/mol, XLogP of 5.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(2,6-dimethylphenyl)-4-phenyl-3-(4-propan-2-ylphenyl)piperazine-2,5-dione is sourced from PubChem (CID 7097601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).