C21H18N2O3S — CID 7693903
(3R)-1-(2-methoxyphenyl)-4-phenyl-3-thiophen-3-ylpiperazine-2,5-dione (PubChem CID 7693903) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is (3R)-1-(2-methoxyphenyl)-4-phenyl-3-thiophen-3-ylpiperazine-2,5-dione.
| Compound Name | (3R)-1-(2-methoxyphenyl)-4-phenyl-3-thiophen-3-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 7693903 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | (3R)-1-(2-methoxyphenyl)-4-phenyl-3-thiophen-3-ylpiperazine-2,5-dione |
| SMILES | COc1ccccc1N1CC(=O)N(c2ccccc2)[C@H](c2ccsc2)C1=O |
| InChI | InChI=1S/C21H18N2O3S/c1-26-18-10-6-5-9-17(18)22-13-19(24)23(16-7-3-2-4-8-16)20(21(22)25)15-11-12-27-14-15/h2-12,14,20H,13H2,1H3/t20-/m1/s1 |
| InChIKey | WBOCQOZJUYQBTH-HXUWFJFHSA-N |
| XLogP | 3.88 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |