C15H24O2 — CID 73331190
(6E,10S)-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-one (PubChem CID 73331190) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (6E,10S)-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-one.
| Compound Name | (6E,10S)-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-one |
|---|---|
| PubChem CID | 73331190 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (6E,10S)-10-hydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-one |
| SMILES | C=C[C@@](C)(O)CC/C=C(\C)CC(=O)C=C(C)C |
| InChI | InChI=1S/C15H24O2/c1-6-15(5,17)9-7-8-13(4)11-14(16)10-12(2)3/h6,8,10,17H,1,7,9,11H2,2-5H3/b13-8+/t15-/m1/s1 |
| InChIKey | NYBCPVODSGRKRC-XETPBLJFSA-N |
| XLogP | 3.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|