C19H25F3N4O — CID 73338463
2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 73338463) has the molecular formula C19H25F3N4O and a molecular weight of 382.43 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 73338463 |
| Molecular Formula | C19H25F3N4O |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | O=C(C1NNC2CCCCC21)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H25F3N4O/c20-19(21,22)13-4-3-5-14(12-13)25-8-10-26(11-9-25)18(27)17-15-6-1-2-7-16(15)23-24-17/h3-5,12,15-17,23-24H,1-2,6-11H2 |
| InChIKey | ZUPODCYXEOPUGR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |