C14H14N4O3S — CID 73338983
6-oxo-N-[4-[2-oxo-2-(prop-2-enylamino)ethyl]-1,3-thiazol-2-yl]-3H-pyridine-3-carboxamide (PubChem CID 73338983) has the molecular formula C14H14N4O3S and a molecular weight of 318.36 g/mol. Its IUPAC name is 6-oxo-N-[4-[2-oxo-2-(prop-2-enylamino)ethyl]-1,3-thiazol-2-yl]-3H-pyridine-3-carboxamide.
| Compound Name | 6-oxo-N-[4-[2-oxo-2-(prop-2-enylamino)ethyl]-1,3-thiazol-2-yl]-3H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 73338983 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 6-oxo-N-[4-[2-oxo-2-(prop-2-enylamino)ethyl]-1,3-thiazol-2-yl]-3H-pyridine-3-carboxamide |
| SMILES | C=CCNC(=O)Cc1csc(NC(=O)C2C=CC(=O)N=C2)n1 |
| InChI | InChI=1S/C14H14N4O3S/c1-2-5-15-12(20)6-10-8-22-14(17-10)18-13(21)9-3-4-11(19)16-7-9/h2-4,7-9H,1,5-6H2,(H,15,20)(H,17,18,21) |
| InChIKey | JKXHHMXCQIVAHJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|