C19H17ClN6O3 — CID 73339957
N-[(2-chlorophenyl)methyl]-N'-[5-methyl-2-(4-methyl-5-methylidene-6-oxopyrimidin-2-yl)pyrazol-3-yl]oxamide (PubChem CID 73339957) has the molecular formula C19H17ClN6O3 and a molecular weight of 412.84 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N'-[5-methyl-2-(4-methyl-5-methylidene-6-oxopyrimidin-2-yl)pyrazol-3-yl]oxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N'-[5-methyl-2-(4-methyl-5-methylidene-6-oxopyrimidin-2-yl)pyrazol-3-yl]oxamide |
|---|---|
| PubChem CID | 73339957 |
| Molecular Formula | C19H17ClN6O3 |
| Molecular Weight | 412.84 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N'-[5-methyl-2-(4-methyl-5-methylidene-6-oxopyrimidin-2-yl)pyrazol-3-yl]oxamide |
| SMILES | C=C1C(=O)N=C(n2nc(C)cc2NC(=O)C(=O)NCc2ccccc2Cl)N=C1C |
| InChI | InChI=1S/C19H17ClN6O3/c1-10-8-15(26(25-10)19-22-12(3)11(2)16(27)24-19)23-18(29)17(28)21-9-13-6-4-5-7-14(13)20/h4-8H,2,9H2,1,3H3,(H,21,28)(H,23,29) |
| InChIKey | BLKNVBBVOCONJB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.84 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|