C21H24N6O4S — CID 73451704
4-(diethylsulfamoyl)-N-[5-methyl-2-(4-methyl-5-methylidene-6-oxopyrimidin-2-yl)pyrazol-3-yl]benzamide (PubChem CID 73451704) has the molecular formula C21H24N6O4S and a molecular weight of 456.53 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[5-methyl-2-(4-methyl-5-methylidene-6-oxopyrimidin-2-yl)pyrazol-3-yl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[5-methyl-2-(4-methyl-5-methylidene-6-oxopyrimidin-2-yl)pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 73451704 |
| Molecular Formula | C21H24N6O4S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[5-methyl-2-(4-methyl-5-methylidene-6-oxopyrimidin-2-yl)pyrazol-3-yl]benzamide |
| SMILES | C=C1C(=O)N=C(n2nc(C)cc2NC(=O)c2ccc(S(=O)(=O)N(CC)CC)cc2)N=C1C |
| InChI | InChI=1S/C21H24N6O4S/c1-6-26(7-2)32(30,31)17-10-8-16(9-11-17)20(29)23-18-12-13(3)25-27(18)21-22-15(5)14(4)19(28)24-21/h8-12H,4,6-7H2,1-3,5H3,(H,23,29) |
| InChIKey | HCLSDNWNDSFMCU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 126.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|