C17H21N — CID 73347790
(8R,9S)-pentacyclo[10.3.1.110,14.01,9.02,7]heptadeca-2,4,6-trien-8-amine (PubChem CID 73347790) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is (8R,9S)-pentacyclo[10.3.1.110,14.01,9.02,7]heptadeca-2,4,6-trien-8-amine.
| Compound Name | (8R,9S)-pentacyclo[10.3.1.110,14.01,9.02,7]heptadeca-2,4,6-trien-8-amine |
|---|---|
| PubChem CID | 73347790 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (8R,9S)-pentacyclo[10.3.1.110,14.01,9.02,7]heptadeca-2,4,6-trien-8-amine |
| SMILES | N[C@H]1c2ccccc2C23CC4CC(CC(C4)[C@H]12)C3 |
| InChI | InChI=1S/C17H21N/c18-16-13-3-1-2-4-14(13)17-8-10-5-11(9-17)7-12(6-10)15(16)17/h1-4,10-12,15-16H,5-9,18H2/t10?,11?,12?,15-,16+,17?/m1/s1 |
| InChIKey | UDRRGNBPEKCWCW-KKXFYESVSA-N |
| XLogP | 3.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |