C13H21N — CID 25099044
(5S,8R,10S)-tetracyclo[6.3.1.16,10.01,5]tridecan-4-amine (PubChem CID 25099044) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (5S,8R,10S)-tetracyclo[6.3.1.16,10.01,5]tridecan-4-amine.
| Compound Name | (5S,8R,10S)-tetracyclo[6.3.1.16,10.01,5]tridecan-4-amine |
|---|---|
| PubChem CID | 25099044 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (5S,8R,10S)-tetracyclo[6.3.1.16,10.01,5]tridecan-4-amine |
| SMILES | NC1CCC23C[C@@H]4CC(C[C@@H](C4)C2)[C@H]13 |
| InChI | InChI=1S/C13H21N/c14-11-1-2-13-6-8-3-9(7-13)5-10(4-8)12(11)13/h8-12H,1-7,14H2/t8-,9+,10?,11?,12-,13?/m1/s1 |
| InChIKey | BCRNJHBCMLTUMK-ZOIYWTSBSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |