C11H18FN — CID 71472119
(1R,3S,4S,6R,8R)-4-fluorotricyclo[4.3.1.13,8]undecan-1-amine (PubChem CID 71472119) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is (1R,3S,4S,6R,8R)-4-fluorotricyclo[4.3.1.13,8]undecan-1-amine.
| Compound Name | (1R,3S,4S,6R,8R)-4-fluorotricyclo[4.3.1.13,8]undecan-1-amine |
|---|---|
| PubChem CID | 71472119 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (1R,3S,4S,6R,8R)-4-fluorotricyclo[4.3.1.13,8]undecan-1-amine |
| SMILES | N[C@@]12C[C@@H]3C[C@@H](C[C@H](F)[C@@H](C3)C1)C2 |
| InChI | InChI=1S/C11H18FN/c12-10-3-8-1-7-2-9(10)6-11(13,4-7)5-8/h7-10H,1-6,13H2/t7-,8+,9+,10+,11-/m1/s1 |
| InChIKey | CPALFHALTRWGAP-ORMBPQIASA-N |
| XLogP | 2.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |