C10H17N — CID 102600925
N,N-dideuterioadamantan-1-amine (PubChem CID 102600925) has the molecular formula C10H17N and a molecular weight of 153.27 g/mol. Its IUPAC name is N,N-dideuterioadamantan-1-amine.
| Compound Name | N,N-dideuterioadamantan-1-amine |
|---|---|
| PubChem CID | 102600925 |
| Molecular Formula | C10H17N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | N,N-dideuterioadamantan-1-amine |
| SMILES | [2H]N([2H])C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H17N/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6,11H2/i/hD2 |
| InChIKey | DKNWSYNQZKUICI-ZSJDYOACSA-N |
| XLogP | 1.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |