About CID 156677932
CID 156677932 (PubChem CID 156677932) has the molecular formula C9H15N2O
and a molecular weight of 167.23 g/mol.
Molecular Properties
| Compound Name | CID 156677932 |
| PubChem CID | 156677932 |
| Molecular Formula | C9H15N2O |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | — |
| SMILES | NC12CC3CC(C1)N([O])C(C3)C2 |
| InChI | InChI=1S/C9H15N2O/c10-9-3-6-1-7(4-9)11(12)8(2-6)5-9/h6-8H,1-5,10H2 |
| InChIKey | SFUPECKBLJFGSO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 49.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 156677932 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156677932?
The IUPAC name of CID 156677932 (CID 156677932) is not available.
What is the SMILES notation for CID 156677932?
The canonical SMILES for CID 156677932 is NC12CC3CC(C1)N([O])C(C3)C2.
What is the InChIKey of CID 156677932?
The InChIKey is SFUPECKBLJFGSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N2O/c10-9-3-6-1-7(4-9)11(12)8(2-6)5-9/h6-8H,1-5,10H2.
What are the key properties of CID 156677932?
CID 156677932 has a molecular weight of 167.23 g/mol, XLogP of 0.68, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156677932 is sourced from PubChem (CID 156677932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).