About adamantan-1-amine;diiminoazanium
adamantan-1-amine;diiminoazanium (PubChem CID 175053883) has the molecular formula C10H19N4+
and a molecular weight of 195.29 g/mol. Its IUPAC name is adamantan-1-amine;diiminoazanium.
Molecular Properties
| Compound Name | adamantan-1-amine;diiminoazanium |
| PubChem CID | 175053883 |
| Molecular Formula | C10H19N4+ |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | adamantan-1-amine;diiminoazanium |
| SMILES | N=[N+]=N.NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H17N.H2N3/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;1-3-2/h7-9H,1-6,11H2;1-2H/q;+1 |
| InChIKey | KYAWEUOWWATBMU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze adamantan-1-amine;diiminoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantan-1-amine;diiminoazanium?
The IUPAC name of adamantan-1-amine;diiminoazanium (CID 175053883) is adamantan-1-amine;diiminoazanium.
What is the SMILES notation for adamantan-1-amine;diiminoazanium?
The canonical SMILES for adamantan-1-amine;diiminoazanium is N=[N+]=N.NC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of adamantan-1-amine;diiminoazanium?
The InChIKey is KYAWEUOWWATBMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N.H2N3/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;1-3-2/h7-9H,1-6,11H2;1-2H/q;+1.
What are the key properties of adamantan-1-amine;diiminoazanium?
adamantan-1-amine;diiminoazanium has a molecular weight of 195.29 g/mol, XLogP of 2.03, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for adamantan-1-amine;diiminoazanium is sourced from PubChem (CID 175053883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).