C12H19F2N — CID 71007853
4-(difluoromethyl)tricyclo[4.3.1.13,8]undecan-1-amine (PubChem CID 71007853) has the molecular formula C12H19F2N and a molecular weight of 215.29 g/mol. Its IUPAC name is 4-(difluoromethyl)tricyclo[4.3.1.13,8]undecan-1-amine.
| Compound Name | 4-(difluoromethyl)tricyclo[4.3.1.13,8]undecan-1-amine |
|---|---|
| PubChem CID | 71007853 |
| Molecular Formula | C12H19F2N |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 4-(difluoromethyl)tricyclo[4.3.1.13,8]undecan-1-amine |
| SMILES | NC12CC3CC(CC(C(F)F)C(C3)C1)C2 |
| InChI | InChI=1S/C12H19F2N/c13-11(14)10-3-8-1-7-2-9(10)6-12(15,4-7)5-8/h7-11H,1-6,15H2 |
| InChIKey | SCMWQMPTRLHDNL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |