C23H20F3N3O2 — CID 73348126
4-[(3aS,4R,8aS,8bR)-7,7-difluoro-2-[(4-fluorophenyl)methyl]-3-hydroxy-1-oxo-3a,4,6,8,8a,8b-hexahydro-3H-pyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile (PubChem CID 73348126) has the molecular formula C23H20F3N3O2 and a molecular weight of 427.43 g/mol. Its IUPAC name is 4-[(3aS,4R,8aS,8bR)-7,7-difluoro-2-[(4-fluorophenyl)methyl]-3-hydroxy-1-oxo-3a,4,6,8,8a,8b-hexahydro-3H-pyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile.
| Compound Name | 4-[(3aS,4R,8aS,8bR)-7,7-difluoro-2-[(4-fluorophenyl)methyl]-3-hydroxy-1-oxo-3a,4,6,8,8a,8b-hexahydro-3H-pyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 73348126 |
| Molecular Formula | C23H20F3N3O2 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 4-[(3aS,4R,8aS,8bR)-7,7-difluoro-2-[(4-fluorophenyl)methyl]-3-hydroxy-1-oxo-3a,4,6,8,8a,8b-hexahydro-3H-pyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@H]2[C@H]3C(O)N(Cc4ccc(F)cc4)C(=O)[C@H]3[C@@H]3CC(F)(F)CN32)cc1 |
| InChI | InChI=1S/C23H20F3N3O2/c24-16-7-3-14(4-8-16)11-28-21(30)18-17-9-23(25,26)12-29(17)20(19(18)22(28)31)15-5-1-13(10-27)2-6-15/h1-8,17-20,22,31H,9,11-12H2/t17-,18-,19-,20-,22?/m0/s1 |
| InChIKey | VZOCOFGVTVDSGZ-VMFLAXOASA-N |
| XLogP | 3.05 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |