C41H34FN3O3 — CID 73349267
2-[4-[4-(2-fluorophenyl)piperazin-1-yl]butyl]-4,10-diphenylindeno[1,2-f]isoindole-1,3,9-trione (PubChem CID 73349267) has the molecular formula C41H34FN3O3 and a molecular weight of 635.74 g/mol. Its IUPAC name is 2-[4-[4-(2-fluorophenyl)piperazin-1-yl]butyl]-4,10-diphenylindeno[1,2-f]isoindole-1,3,9-trione.
| Compound Name | 2-[4-[4-(2-fluorophenyl)piperazin-1-yl]butyl]-4,10-diphenylindeno[1,2-f]isoindole-1,3,9-trione |
|---|---|
| PubChem CID | 73349267 |
| Molecular Formula | C41H34FN3O3 |
| Molecular Weight | 635.74 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | 2-[4-[4-(2-fluorophenyl)piperazin-1-yl]butyl]-4,10-diphenylindeno[1,2-f]isoindole-1,3,9-trione |
| SMILES | O=c1c2ccccc2c2c(-c3ccccc3)c3c(=O)n(CCCCN4CCN(c5ccccc5F)CC4)c(=O)c3c(-c3ccccc3)c12 |
| InChI | InChI=1S/C41H34FN3O3/c42-31-19-9-10-20-32(31)44-25-23-43(24-26-44)21-11-12-22-45-40(47)37-33(27-13-3-1-4-14-27)35-29-17-7-8-18-30(29)39(46)36(35)34(38(37)41(45)48)28-15-5-2-6-16-28/h1-10,13-20H,11-12,21-26H2 |
| InChIKey | QWWOOJDKMCPGRW-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.74 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|