C16H14IN3 — CID 73350446
4-[(E)-2-(6-iodo-1H-benzimidazol-2-yl)ethenyl]-N-methylaniline (PubChem CID 73350446) has the molecular formula C16H14IN3 and a molecular weight of 375.21 g/mol. Its IUPAC name is 4-[(E)-2-(6-iodo-1H-benzimidazol-2-yl)ethenyl]-N-methylaniline.
| Compound Name | 4-[(E)-2-(6-iodo-1H-benzimidazol-2-yl)ethenyl]-N-methylaniline |
|---|---|
| PubChem CID | 73350446 |
| Molecular Formula | C16H14IN3 |
| Molecular Weight | 375.21 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 4-[(E)-2-(6-iodo-1H-benzimidazol-2-yl)ethenyl]-N-methylaniline |
| SMILES | CNc1ccc(/C=C/c2nc3ccc(I)cc3[nH]2)cc1 |
| InChI | InChI=1S/C16H14IN3/c1-18-13-6-2-11(3-7-13)4-9-16-19-14-8-5-12(17)10-15(14)20-16/h2-10,18H,1H3,(H,19,20)/b9-4+ |
| InChIKey | UACJAEPUZXTOBN-RUDMXATFSA-N |
| XLogP | 4.38 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.21 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|