C20H18N6O2S3 — CID 73353663
1-[4-[4-(2,4-dimethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]-1,3-thiazol-2-yl]-3-phenylthiourea (PubChem CID 73353663) has the molecular formula C20H18N6O2S3 and a molecular weight of 470.61 g/mol. Its IUPAC name is 1-[4-[4-(2,4-dimethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]-1,3-thiazol-2-yl]-3-phenylthiourea.
| Compound Name | 1-[4-[4-(2,4-dimethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]-1,3-thiazol-2-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 73353663 |
| Molecular Formula | C20H18N6O2S3 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 1-[4-[4-(2,4-dimethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]-1,3-thiazol-2-yl]-3-phenylthiourea |
| SMILES | COc1ccc(-n2c(-c3csc(NC(=S)Nc4ccccc4)n3)n[nH]c2=S)c(OC)c1 |
| InChI | InChI=1S/C20H18N6O2S3/c1-27-13-8-9-15(16(10-13)28-2)26-17(24-25-20(26)30)14-11-31-19(22-14)23-18(29)21-12-6-4-3-5-7-12/h3-11H,1-2H3,(H,25,30)(H2,21,22,23,29) |
| InChIKey | VAYZCKOXESGWHX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|