C22H29BrN8 — CID 73355074
2-N-(4-aminocyclohexyl)-6-N-[(6-bromo-3-pyridinyl)methyl]-9-cyclopentylpurine-2,6-diamine (PubChem CID 73355074) has the molecular formula C22H29BrN8 and a molecular weight of 485.43 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-6-N-[(6-bromo-3-pyridinyl)methyl]-9-cyclopentylpurine-2,6-diamine.
| Compound Name | 2-N-(4-aminocyclohexyl)-6-N-[(6-bromo-3-pyridinyl)methyl]-9-cyclopentylpurine-2,6-diamine |
|---|---|
| PubChem CID | 73355074 |
| Molecular Formula | C22H29BrN8 |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-6-N-[(6-bromo-3-pyridinyl)methyl]-9-cyclopentylpurine-2,6-diamine |
| SMILES | NC1CCC(Nc2nc(NCc3ccc(Br)nc3)c3ncn(C4CCCC4)c3n2)CC1 |
| InChI | InChI=1S/C22H29BrN8/c23-18-10-5-14(11-25-18)12-26-20-19-21(31(13-27-19)17-3-1-2-4-17)30-22(29-20)28-16-8-6-15(24)7-9-16/h5,10-11,13,15-17H,1-4,6-9,12,24H2,(H2,26,28,29,30) |
| InChIKey | ZGIJHVOJVKEPEE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|