C26H34FN5O4 — CID 73355212
N-(2,3-dihydroxypropyl)-2-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1-(3-methoxypropyl)benzimidazole-5-carboxamide (PubChem CID 73355212) has the molecular formula C26H34FN5O4 and a molecular weight of 499.59 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1-(3-methoxypropyl)benzimidazole-5-carboxamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1-(3-methoxypropyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 73355212 |
| Molecular Formula | C26H34FN5O4 |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-1-(3-methoxypropyl)benzimidazole-5-carboxamide |
| SMILES | COCCCn1c(CN2CCN(c3ccccc3F)CC2)nc2cc(C(=O)NCC(O)CO)ccc21 |
| InChI | InChI=1S/C26H34FN5O4/c1-36-14-4-9-32-24-8-7-19(26(35)28-16-20(34)18-33)15-22(24)29-25(32)17-30-10-12-31(13-11-30)23-6-3-2-5-21(23)27/h2-3,5-8,15,20,33-34H,4,9-14,16-18H2,1H3,(H,28,35) |
| InChIKey | JIMMIDQOUJDVBF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|