C16H27N9O4 — CID 73355508
methyl 2-[[(2S)-2-[[(2R,3S,5R)-3,5-bis(azidomethyl)pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]acetate (PubChem CID 73355508) has the molecular formula C16H27N9O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-[[(2R,3S,5R)-3,5-bis(azidomethyl)pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]acetate.
| Compound Name | methyl 2-[[(2S)-2-[[(2R,3S,5R)-3,5-bis(azidomethyl)pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]acetate |
|---|---|
| PubChem CID | 73355508 |
| Molecular Formula | C16H27N9O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | methyl 2-[[(2S)-2-[[(2R,3S,5R)-3,5-bis(azidomethyl)pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@@H]1N[C@@H](CN=[N+]=[N-])C[C@H]1CN=[N+]=[N-] |
| InChI | InChI=1S/C16H27N9O4/c1-9(2)4-12(15(27)19-8-13(26)29-3)23-16(28)14-10(6-20-24-17)5-11(22-14)7-21-25-18/h9-12,14,22H,4-8H2,1-3H3,(H,19,27)(H,23,28)/t10-,11+,12-,14+/m0/s1 |
| InChIKey | FAZUKMXYEGDDDJ-KZVDOYCCSA-N |
| XLogP | 0.77 |
| TPSA | 194.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|