C19H28N4O4S — CID 73355580
1-(4-cyclohexylbutyl)-3-[[2-(4-nitrophenoxy)acetyl]amino]thiourea (PubChem CID 73355580) has the molecular formula C19H28N4O4S and a molecular weight of 408.52 g/mol. Its IUPAC name is 1-(4-cyclohexylbutyl)-3-[[2-(4-nitrophenoxy)acetyl]amino]thiourea.
| Compound Name | 1-(4-cyclohexylbutyl)-3-[[2-(4-nitrophenoxy)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 73355580 |
| Molecular Formula | C19H28N4O4S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-(4-cyclohexylbutyl)-3-[[2-(4-nitrophenoxy)acetyl]amino]thiourea |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)NNC(=S)NCCCCC1CCCCC1 |
| InChI | InChI=1S/C19H28N4O4S/c24-18(14-27-17-11-9-16(10-12-17)23(25)26)21-22-19(28)20-13-5-4-8-15-6-2-1-3-7-15/h9-12,15H,1-8,13-14H2,(H,21,24)(H2,20,22,28) |
| InChIKey | YDMFQFGWICWKSM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|