C24H27N3O2S — CID 7336575
(4S)-3-cyano-4-(furan-2-yl)-2-hexylsulfanyl-6-methyl-N-phenyl-3,4-dihydropyridine-5-carboxamide (PubChem CID 7336575) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is (4S)-3-cyano-4-(furan-2-yl)-2-hexylsulfanyl-6-methyl-N-phenyl-3,4-dihydropyridine-5-carboxamide.
| Compound Name | (4S)-3-cyano-4-(furan-2-yl)-2-hexylsulfanyl-6-methyl-N-phenyl-3,4-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 7336575 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | (4S)-3-cyano-4-(furan-2-yl)-2-hexylsulfanyl-6-methyl-N-phenyl-3,4-dihydropyridine-5-carboxamide |
| SMILES | CCCCCCSC1=NC(C)=C(C(=O)Nc2ccccc2)[C@@H](c2ccco2)C1C#N |
| InChI | InChI=1S/C24H27N3O2S/c1-3-4-5-9-15-30-24-19(16-25)22(20-13-10-14-29-20)21(17(2)26-24)23(28)27-18-11-7-6-8-12-18/h6-8,10-14,19,22H,3-5,9,15H2,1-2H3,(H,27,28)/t19?,22-/m1/s1 |
| InChIKey | URDREAUOOBCDKA-AVKWCDSFSA-N |
| XLogP | 6.14 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|