C26H29N3O3S — CID 91283570
2-butylsulfanyl-3-cyano-N,4-bis(2-methoxyphenyl)-6-methyl-3,4-dihydropyridine-5-carboxamide (PubChem CID 91283570) has the molecular formula C26H29N3O3S and a molecular weight of 463.60 g/mol. Its IUPAC name is 2-butylsulfanyl-3-cyano-N,4-bis(2-methoxyphenyl)-6-methyl-3,4-dihydropyridine-5-carboxamide.
| Compound Name | 2-butylsulfanyl-3-cyano-N,4-bis(2-methoxyphenyl)-6-methyl-3,4-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 91283570 |
| Molecular Formula | C26H29N3O3S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 2-butylsulfanyl-3-cyano-N,4-bis(2-methoxyphenyl)-6-methyl-3,4-dihydropyridine-5-carboxamide |
| SMILES | CCCCSC1=NC(C)=C(C(=O)Nc2ccccc2OC)C(c2ccccc2OC)C1C#N |
| InChI | InChI=1S/C26H29N3O3S/c1-5-6-15-33-26-19(16-27)24(18-11-7-9-13-21(18)31-3)23(17(2)28-26)25(30)29-20-12-8-10-14-22(20)32-4/h7-14,19,24H,5-6,15H2,1-4H3,(H,29,30) |
| InChIKey | ZDKSSGARVQTXGM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|