C25H25N3O3 — CID 91144473
3-isocyano-N-(2-methoxyphenyl)-2,6-dimethyl-4-(2-prop-2-enoxyphenyl)-3,4-dihydropyridine-5-carboxamide (PubChem CID 91144473) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 3-isocyano-N-(2-methoxyphenyl)-2,6-dimethyl-4-(2-prop-2-enoxyphenyl)-3,4-dihydropyridine-5-carboxamide.
| Compound Name | 3-isocyano-N-(2-methoxyphenyl)-2,6-dimethyl-4-(2-prop-2-enoxyphenyl)-3,4-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 91144473 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 3-isocyano-N-(2-methoxyphenyl)-2,6-dimethyl-4-(2-prop-2-enoxyphenyl)-3,4-dihydropyridine-5-carboxamide |
| SMILES | [C-]#[N+]C1C(C)=NC(C)=C(C(=O)Nc2ccccc2OC)C1c1ccccc1OCC=C |
| InChI | InChI=1S/C25H25N3O3/c1-6-15-31-20-13-9-7-11-18(20)23-22(16(2)27-17(3)24(23)26-4)25(29)28-19-12-8-10-14-21(19)30-5/h6-14,23-24H,1,15H2,2-3,5H3,(H,28,29) |
| InChIKey | WYFCTBJUMMRIQX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 64.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|