C28H22Cl2N4O4S — CID 91425064
3-cyano-4-(2,4-dichlorophenyl)-N-(2-methoxyphenyl)-6-methyl-2-[(3-nitrophenyl)methylsulfanyl]-3,4-dihydropyridine-5-carboxamide (PubChem CID 91425064) has the molecular formula C28H22Cl2N4O4S and a molecular weight of 581.48 g/mol. Its IUPAC name is 3-cyano-4-(2,4-dichlorophenyl)-N-(2-methoxyphenyl)-6-methyl-2-[(3-nitrophenyl)methylsulfanyl]-3,4-dihydropyridine-5-carboxamide.
| Compound Name | 3-cyano-4-(2,4-dichlorophenyl)-N-(2-methoxyphenyl)-6-methyl-2-[(3-nitrophenyl)methylsulfanyl]-3,4-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 91425064 |
| Molecular Formula | C28H22Cl2N4O4S |
| Molecular Weight | 581.48 g/mol |
| Exact Mass | 580.07 |
| IUPAC Name | 3-cyano-4-(2,4-dichlorophenyl)-N-(2-methoxyphenyl)-6-methyl-2-[(3-nitrophenyl)methylsulfanyl]-3,4-dihydropyridine-5-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=C(C)N=C(SCc2cccc([N+](=O)[O-])c2)C(C#N)C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H22Cl2N4O4S/c1-16-25(27(35)33-23-8-3-4-9-24(23)38-2)26(20-11-10-18(29)13-22(20)30)21(14-31)28(32-16)39-15-17-6-5-7-19(12-17)34(36)37/h3-13,21,26H,15H2,1-2H3,(H,33,35) |
| InChIKey | UUTFYVOLYLITSK-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.48 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|