C13H12N3O7- — CID 7337924
3-ethoxycarbonyl-1,2-dimethyl-4,6-dinitroindol-5-olate (PubChem CID 7337924) has the molecular formula C13H12N3O7- and a molecular weight of 322.25 g/mol. Its IUPAC name is 3-ethoxycarbonyl-1,2-dimethyl-4,6-dinitroindol-5-olate.
| Compound Name | 3-ethoxycarbonyl-1,2-dimethyl-4,6-dinitroindol-5-olate |
|---|---|
| PubChem CID | 7337924 |
| Molecular Formula | C13H12N3O7- |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 3-ethoxycarbonyl-1,2-dimethyl-4,6-dinitroindol-5-olate |
| SMILES | CCOC(=O)c1c(C)n(C)c2cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c12 |
| InChI | InChI=1S/C13H13N3O7/c1-4-23-13(18)9-6(2)14(3)7-5-8(15(19)20)12(17)11(10(7)9)16(21)22/h5,17H,4H2,1-3H3/p-1 |
| InChIKey | PBNUPOARCGPMPA-UHFFFAOYSA-M |
| XLogP | 1.55 |
| TPSA | 140.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|