About N-(3,5-dimethylbenzoyl)-3,5-dimethyl-N-pyrimidin-2-ylbenzamide
N-(3,5-dimethylbenzoyl)-3,5-dimethyl-N-pyrimidin-2-ylbenzamide (PubChem CID 7338613) has the molecular formula C22H21N3O2
and a molecular weight of 359.43 g/mol. Its IUPAC name is N-(3,5-dimethylbenzoyl)-3,5-dimethyl-N-pyrimidin-2-ylbenzamide.
Molecular Properties
| Compound Name | N-(3,5-dimethylbenzoyl)-3,5-dimethyl-N-pyrimidin-2-ylbenzamide |
| PubChem CID | 7338613 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-(3,5-dimethylbenzoyl)-3,5-dimethyl-N-pyrimidin-2-ylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)N(C(=O)c2cc(C)cc(C)c2)c2ncccn2)c1 |
| InChI | InChI=1S/C22H21N3O2/c1-14-8-15(2)11-18(10-14)20(26)25(22-23-6-5-7-24-22)21(27)19-12-16(3)9-17(4)13-19/h5-13H,1-4H3 |
| InChIKey | FEVOTFQQXFGYJG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-dimethylbenzoyl)-3,5-dimethyl-N-pyrimidin-2-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethylbenzoyl)-3,5-dimethyl-N-pyrimidin-2-ylbenzamide?
The IUPAC name of N-(3,5-dimethylbenzoyl)-3,5-dimethyl-N-pyrimidin-2-ylbenzamide (CID 7338613) is N-(3,5-dimethylbenzoyl)-3,5-dimethyl-N-pyrimidin-2-ylbenzamide.
What is the SMILES notation for N-(3,5-dimethylbenzoyl)-3,5-dimethyl-N-pyrimidin-2-ylbenzamide?
The canonical SMILES for N-(3,5-dimethylbenzoyl)-3,5-dimethyl-N-pyrimidin-2-ylbenzamide is Cc1cc(C)cc(C(=O)N(C(=O)c2cc(C)cc(C)c2)c2ncccn2)c1.
What is the InChIKey of N-(3,5-dimethylbenzoyl)-3,5-dimethyl-N-pyrimidin-2-ylbenzamide?
The InChIKey is FEVOTFQQXFGYJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O2/c1-14-8-15(2)11-18(10-14)20(26)25(22-23-6-5-7-24-22)21(27)19-12-16(3)9-17(4)13-19/h5-13H,1-4H3.
What are the key properties of N-(3,5-dimethylbenzoyl)-3,5-dimethyl-N-pyrimidin-2-ylbenzamide?
N-(3,5-dimethylbenzoyl)-3,5-dimethyl-N-pyrimidin-2-ylbenzamide has a molecular weight of 359.43 g/mol, XLogP of 4.20, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethylbenzoyl)-3,5-dimethyl-N-pyrimidin-2-ylbenzamide is sourced from PubChem (CID 7338613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).