About N'-benzyl-N-[(4-fluorophenyl)methyl]-N'-methylbut-2-enediamide
N'-benzyl-N-[(4-fluorophenyl)methyl]-N'-methylbut-2-enediamide (PubChem CID 73386163) has the molecular formula C19H19FN2O2
and a molecular weight of 326.37 g/mol. Its IUPAC name is N'-benzyl-N-[(4-fluorophenyl)methyl]-N'-methylbut-2-enediamide.
Molecular Properties
| Compound Name | N'-benzyl-N-[(4-fluorophenyl)methyl]-N'-methylbut-2-enediamide |
| PubChem CID | 73386163 |
| Molecular Formula | C19H19FN2O2 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N'-benzyl-N-[(4-fluorophenyl)methyl]-N'-methylbut-2-enediamide |
| SMILES | CN(Cc1ccccc1)C(=O)C=CC(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H19FN2O2/c1-22(14-16-5-3-2-4-6-16)19(24)12-11-18(23)21-13-15-7-9-17(20)10-8-15/h2-12H,13-14H2,1H3,(H,21,23) |
| InChIKey | ITZHJHMMKMLNMS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-N-[(4-fluorophenyl)methyl]-N'-methylbut-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N-[(4-fluorophenyl)methyl]-N'-methylbut-2-enediamide?
The IUPAC name of N'-benzyl-N-[(4-fluorophenyl)methyl]-N'-methylbut-2-enediamide (CID 73386163) is N'-benzyl-N-[(4-fluorophenyl)methyl]-N'-methylbut-2-enediamide.
What is the SMILES notation for N'-benzyl-N-[(4-fluorophenyl)methyl]-N'-methylbut-2-enediamide?
The canonical SMILES for N'-benzyl-N-[(4-fluorophenyl)methyl]-N'-methylbut-2-enediamide is CN(Cc1ccccc1)C(=O)C=CC(=O)NCc1ccc(F)cc1.
What is the InChIKey of N'-benzyl-N-[(4-fluorophenyl)methyl]-N'-methylbut-2-enediamide?
The InChIKey is ITZHJHMMKMLNMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FN2O2/c1-22(14-16-5-3-2-4-6-16)19(24)12-11-18(23)21-13-15-7-9-17(20)10-8-15/h2-12H,13-14H2,1H3,(H,21,23).
What are the key properties of N'-benzyl-N-[(4-fluorophenyl)methyl]-N'-methylbut-2-enediamide?
N'-benzyl-N-[(4-fluorophenyl)methyl]-N'-methylbut-2-enediamide has a molecular weight of 326.37 g/mol, XLogP of 2.66, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N-[(4-fluorophenyl)methyl]-N'-methylbut-2-enediamide is sourced from PubChem (CID 73386163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).