C30H34N4O6S2 — CID 73387468
S-[(E)-4-[(4Z,7S,10S)-7-benzyl-4-ethylidene-16-methylsulfanyl-2,5,8,12-tetraoxo-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(19),15,17-trien-10-yl]but-3-enyl] ethanethioate (PubChem CID 73387468) has the molecular formula C30H34N4O6S2 and a molecular weight of 610.76 g/mol. Its IUPAC name is S-[(E)-4-[(4Z,7S,10S)-7-benzyl-4-ethylidene-16-methylsulfanyl-2,5,8,12-tetraoxo-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(19),15,17-trien-10-yl]but-3-enyl] ethanethioate.
| Compound Name | S-[(E)-4-[(4Z,7S,10S)-7-benzyl-4-ethylidene-16-methylsulfanyl-2,5,8,12-tetraoxo-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(19),15,17-trien-10-yl]but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 73387468 |
| Molecular Formula | C30H34N4O6S2 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.19 |
| IUPAC Name | S-[(E)-4-[(4Z,7S,10S)-7-benzyl-4-ethylidene-16-methylsulfanyl-2,5,8,12-tetraoxo-9-oxa-3,6,13,19-tetrazabicyclo[13.3.1]nonadeca-1(19),15,17-trien-10-yl]but-3-enyl] ethanethioate |
| SMILES | C/C=C1\NC(=O)c2ccc(SC)c(n2)CNC(=O)C[C@@H](/C=C/CCSC(C)=O)OC(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C30H34N4O6S2/c1-4-22-28(37)34-24(16-20-10-6-5-7-11-20)30(39)40-21(12-8-9-15-42-19(2)35)17-27(36)31-18-25-26(41-3)14-13-23(32-25)29(38)33-22/h4-8,10-14,21,24H,9,15-18H2,1-3H3,(H,31,36)(H,33,38)(H,34,37)/b12-8+,22-4-/t21-,24+/m1/s1 |
| InChIKey | YLYCUHNPOPGKGD-LHBSKMOASA-N |
| XLogP | 3.32 |
| TPSA | 143.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|