C16H25N6O3+ — CID 73393944
7-butyl-1-(3-hydroxypropyl)-3,9-dimethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione (PubChem CID 73393944) has the molecular formula C16H25N6O3+ and a molecular weight of 349.42 g/mol. Its IUPAC name is 7-butyl-1-(3-hydroxypropyl)-3,9-dimethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione.
| Compound Name | 7-butyl-1-(3-hydroxypropyl)-3,9-dimethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
|---|---|
| PubChem CID | 73393944 |
| Molecular Formula | C16H25N6O3+ |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 7-butyl-1-(3-hydroxypropyl)-3,9-dimethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
| SMILES | CCCCN1C(=O)C2C(=NC3=[N+]2CC(C)=NN3CCCO)N(C)C1=O |
| InChI | InChI=1S/C16H25N6O3/c1-4-5-7-20-14(24)12-13(19(3)16(20)25)17-15-21(12)10-11(2)18-22(15)8-6-9-23/h12,23H,4-10H2,1-3H3/q+1 |
| InChIKey | KCUSIFZMJHEJDZ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|